EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O4 |
| Net Charge | 0 |
| Average Mass | 322.360 |
| Monoisotopic Mass | 322.12051 |
| SMILES | Cc1c(O)c2c(c3c1OC(C)(C)C=C3)C=Cc1c(O)cccc1O2 |
| InChI | InChI=1S/C20H18O4/c1-11-17(22)19-12(13-9-10-20(2,3)24-18(11)13)7-8-14-15(21)5-4-6-16(14)23-19/h4-10,21-22H,1-3H3 |
| InChIKey | BQFBLGBPUARBGM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bauhinia saccocalyx (IPNI:481650-1) | root (BTO:0001188) | DOI (10.1002/hlca.200490006) |
| Roles Classification |
|---|
| Biological Roles: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bauhinoxepin A (CHEBI:65468) has role antimycobacterial drug (CHEBI:64912) |
| bauhinoxepin A (CHEBI:65468) has role metabolite (CHEBI:25212) |
| bauhinoxepin A (CHEBI:65468) is a cyclic ether (CHEBI:37407) |
| bauhinoxepin A (CHEBI:65468) is a organic heterotetracyclic compound (CHEBI:38163) |
| bauhinoxepin A (CHEBI:65468) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 3,3,5-trimethyl-3H-chromeno[6,5-b][1]benzoxepine-6,11-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9794360 | Reaxys |