EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O4 |
| Net Charge | 0 |
| Average Mass | 322.360 |
| Monoisotopic Mass | 322.12051 |
| SMILES | Cc1c(O)c2c(c3c1OC(C)(C)C=C3)C=Cc1c(O)cccc1O2 |
| InChI | InChI=1S/C20H18O4/c1-11-17(22)19-12(13-9-10-20(2,3)24-18(11)13)7-8-14-15(21)5-4-6-16(14)23-19/h4-10,21-22H,1-3H3 |
| InChIKey | BQFBLGBPUARBGM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bauhinia saccocalyx (IPNI:481650-1) | root (BTO:0001188) | DOI (10.1002/hlca.200490006) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| Application: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bauhinoxepin A (CHEBI:65468) has role antimycobacterial drug (CHEBI:64912) |
| bauhinoxepin A (CHEBI:65468) has role metabolite (CHEBI:25212) |
| bauhinoxepin A (CHEBI:65468) is a cyclic ether (CHEBI:37407) |
| bauhinoxepin A (CHEBI:65468) is a organic heterotetracyclic compound (CHEBI:38163) |
| bauhinoxepin A (CHEBI:65468) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 3,3,5-trimethyl-3H-chromeno[6,5-b][1]benzoxepine-6,11-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9794360 | Reaxys |