EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H67N9O4 |
| Net Charge | 0 |
| Average Mass | 738.035 |
| Monoisotopic Mass | 737.53160 |
| SMILES | [H][C@]12CC[C@]3([H])C(C(=O)OCCCCCCCCCC4NC(=N)N5CCCC5=C4C(=O)OCCCCNC(=N)N)=C(C)N=C(N[C@H](CCCCCCC)C1)N23 |
| InChI | InChI=1S/C40H67N9O4/c1-3-4-5-9-12-18-29-27-30-21-22-33-34(28(2)45-40(46-29)49(30)33)36(50)52-25-15-11-8-6-7-10-13-19-31-35(32-20-17-24-48(32)39(43)47-31)37(51)53-26-16-14-23-44-38(41)42/h29-31,33H,3-27H2,1-2H3,(H2,43,47)(H,45,46)(H4,41,42,44)/t29-,30+,31?,33-/m1/s1 |
| InChIKey | CFRXQGXKLCOKGG-BNKKYZKKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Batzella (ITIS:659394) | - | DOI (10.1021/jo00110a021) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| batzelladine B (CHEBI:65467) has role anti-HIV-1 agent (CHEBI:64947) |
| batzelladine B (CHEBI:65467) has role metabolite (CHEBI:25212) |
| batzelladine B (CHEBI:65467) is a alkaloid (CHEBI:22315) |
| batzelladine B (CHEBI:65467) is a carboxylic ester (CHEBI:33308) |
| batzelladine B (CHEBI:65467) is a guanidines (CHEBI:24436) |
| batzelladine B (CHEBI:65467) is a organic heterotricyclic compound (CHEBI:26979) |
| batzelladine B (CHEBI:65467) is a pyrrolopyrimidine (CHEBI:38670) |
| batzelladine B (CHEBI:65467) is a triazaacenaphthylene (CHEBI:88047) |
| IUPAC Name |
|---|
| 9-{4-[(4-carbamimidamidobutoxy)carbonyl]-1-imino-1,2,3,5,6,7-hexahydropyrrolo[1,2-c]pyrimidin-3-yl}nonyl (2aR,7R,8aS)-7-heptyl-4-methyl-2,2a,6,7,8,8a-hexahydro-1H-5,6,8b-triazaacenaphthylene-3-carboxylate |
| Synonym | Source |
|---|---|
| 1H-5,6,8b-Triazaacenaphthylene-3-carboxylic acid, 7-heptyl-2,2a,6,7,8,8a-hexahydro-4-methyl-, 9-(4-((4-((aminoiminomethyl)amino)butoxy)carbonyl)-1,2,3,5,6,7-hexahydro-1-iminopyrrolo(1,2-c)pyrimidin-3-yl)nonyl ester, (7S)- | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:161503-23-7 | ChemIDplus |
| Citations |
|---|