EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO3 |
| Net Charge | 0 |
| Average Mass | 261.321 |
| Monoisotopic Mass | 261.13649 |
| SMILES | CC(C)[C@H]1OC(=O)[C@H](Cc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C15H19NO3/c1-10(2)13-14(17)16(3)12(15(18)19-13)9-11-7-5-4-6-8-11/h4-8,10,12-13H,9H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | YOKBTBNVNCFOBF-QWHCGFSZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beauveria bassiana (ncbitaxon:176275) | - | PubMed (8557595) | Strain: K 717 |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bassiatin (CHEBI:65465) has role antimicrobial agent (CHEBI:33281) |
| bassiatin (CHEBI:65465) has role metabolite (CHEBI:25212) |
| bassiatin (CHEBI:65465) has role platelet aggregation inhibitor (CHEBI:50427) |
| bassiatin (CHEBI:65465) is a diketone (CHEBI:46640) |
| bassiatin (CHEBI:65465) is a morpholines (CHEBI:38785) |
| IUPAC Name |
|---|
| (3S,6R)-3-benzyl-4-methyl-6-(propan-2-yl)morpholine-2,5-dione |
| Synonyms | Source |
|---|---|
| (3S,6R)-3-benzyl-6-isopropyl-4-methyl-2,5-morpholinedione | ChEBI |
| (3S,6R)-4-methyl-6-(1-methylethyl)-3-phenylmethyl-1,4-perhydrooxazine-2,5-dione | ChEBI |
| (3S,6R)-4-methyl-6-(1-methylethyl)-3-(phenylmethyl)-2,5-morpholinedione | ChEBI |
| Lateritin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7466012 | Reaxys |
| CAS:65454-13-9 | ChemIDplus |
| Citations |
|---|