EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO3 |
| Net Charge | 0 |
| Average Mass | 261.321 |
| Monoisotopic Mass | 261.13649 |
| SMILES | CC(C)[C@H]1OC(=O)[C@H](Cc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C15H19NO3/c1-10(2)13-14(17)16(3)12(15(18)19-13)9-11-7-5-4-6-8-11/h4-8,10,12-13H,9H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | YOKBTBNVNCFOBF-QWHCGFSZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beauveria bassiana (ncbitaxon:176275) | - | PubMed (8557595) | Strain: K 717 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bassiatin (CHEBI:65465) has role antimicrobial agent (CHEBI:33281) |
| bassiatin (CHEBI:65465) has role metabolite (CHEBI:25212) |
| bassiatin (CHEBI:65465) has role platelet aggregation inhibitor (CHEBI:50427) |
| bassiatin (CHEBI:65465) is a diketone (CHEBI:46640) |
| bassiatin (CHEBI:65465) is a morpholines (CHEBI:38785) |
| IUPAC Name |
|---|
| (3S,6R)-3-benzyl-4-methyl-6-(propan-2-yl)morpholine-2,5-dione |
| Synonyms | Source |
|---|---|
| (3S,6R)-4-methyl-6-(1-methylethyl)-3-phenylmethyl-1,4-perhydrooxazine-2,5-dione | ChEBI |
| Lateritin | ChemIDplus |
| (3S,6R)-4-methyl-6-(1-methylethyl)-3-(phenylmethyl)-2,5-morpholinedione | ChEBI |
| (3S,6R)-3-benzyl-6-isopropyl-4-methyl-2,5-morpholinedione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7466012 | Reaxys |
| CAS:65454-13-9 | ChemIDplus |
| Citations |
|---|