EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | [H]C1(CC[C@@]2(C)[C@H](C)CC[C@@]3(C)C(C(=O)O)=CCC[C@@]32[H])CCOC1=O |
| InChI | InChI=1S/C20H30O4/c1-13-7-10-20(3)15(17(21)22)5-4-6-16(20)19(13,2)11-8-14-9-12-24-18(14)23/h5,13-14,16H,4,6-12H2,1-3H3,(H,21,22)/t13-,14?,16-,19+,20+/m1/s1 |
| InChIKey | KLTOIXCFCZRIFD-BBOKRCSFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ballota limbata (IPNI:444966-1) | whole plant (BTO:0001461) | PubMed (15056960) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ballotenic acid (CHEBI:65462) has role lipoxygenase inhibitor (CHEBI:35856) |
| ballotenic acid (CHEBI:65462) has role metabolite (CHEBI:25212) |
| ballotenic acid (CHEBI:65462) is a carbobicyclic compound (CHEBI:36785) |
| ballotenic acid (CHEBI:65462) is a diterpenoid (CHEBI:23849) |
| ballotenic acid (CHEBI:65462) is a monocarboxylic acid (CHEBI:25384) |
| ballotenic acid (CHEBI:65462) is a octahydronaphthalenes (CHEBI:138397) |
| ballotenic acid (CHEBI:65462) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (4aR,5S,6R,8aR)-5,6,8a-trimethyl-5-[2-(2-oxotetrahydrofuran-3-yl)ethyl]-3,4,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9804328 | Reaxys |
| Citations |
|---|