EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | [H]C1(CC[C@@]2(C)[C@H](C)CC[C@@]3(C)C(C(=O)O)=CCC[C@@]32[H])CCOC1=O |
| InChI | InChI=1S/C20H30O4/c1-13-7-10-20(3)15(17(21)22)5-4-6-16(20)19(13,2)11-8-14-9-12-24-18(14)23/h5,13-14,16H,4,6-12H2,1-3H3,(H,21,22)/t13-,14?,16-,19+,20+/m1/s1 |
| InChIKey | KLTOIXCFCZRIFD-BBOKRCSFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ballota limbata (IPNI:444966-1) | whole plant (BTO:0001461) | PubMed (15056960) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ballotenic acid (CHEBI:65462) has role lipoxygenase inhibitor (CHEBI:35856) |
| ballotenic acid (CHEBI:65462) has role metabolite (CHEBI:25212) |
| ballotenic acid (CHEBI:65462) is a carbobicyclic compound (CHEBI:36785) |
| ballotenic acid (CHEBI:65462) is a diterpenoid (CHEBI:23849) |
| ballotenic acid (CHEBI:65462) is a monocarboxylic acid (CHEBI:25384) |
| ballotenic acid (CHEBI:65462) is a octahydronaphthalenes (CHEBI:138397) |
| ballotenic acid (CHEBI:65462) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (4aR,5S,6R,8aR)-5,6,8a-trimethyl-5-[2-(2-oxotetrahydrofuran-3-yl)ethyl]-3,4,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9804328 | Reaxys |
| Citations |
|---|