EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11N3O3 |
| Net Charge | 0 |
| Average Mass | 161.161 |
| Monoisotopic Mass | 161.08004 |
| SMILES | C/N=[N+](\[O-])CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11N3O3/c1-7-8(11)3-2-4(6)5(9)10/h4H,2-3,6H2,1H3,(H,9,10)/b8-7-/t4-/m0/s1 |
| InChIKey | KFZWEFIJHQUPCM-JMRMDATBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus cereus (ncbitaxon:1396) | - | PubMed (8071129) | Strain: NR2991 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azoxybacilin (CHEBI:65461) has role antifungal agent (CHEBI:35718) |
| azoxybacilin (CHEBI:65461) has role antimicrobial agent (CHEBI:33281) |
| azoxybacilin (CHEBI:65461) has role bacterial metabolite (CHEBI:76969) |
| azoxybacilin (CHEBI:65461) is a azoxy compound (CHEBI:37390) |
| azoxybacilin (CHEBI:65461) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-[(Z)-methyl-NNO-azoxy]butanoic acid |
| Synonym | Source |
|---|---|
| [(3S)-3-amino-4-hydroxy-4-oxobutyl]-(Z)-methylimino-oxidoazanium | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7074303 | Reaxys |
| CAS:157998-96-4 | ChemIDplus |
| Citations |
|---|