EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11N3O3 |
| Net Charge | 0 |
| Average Mass | 161.161 |
| Monoisotopic Mass | 161.08004 |
| SMILES | C/N=[N+](\[O-])CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11N3O3/c1-7-8(11)3-2-4(6)5(9)10/h4H,2-3,6H2,1H3,(H,9,10)/b8-7-/t4-/m0/s1 |
| InChIKey | KFZWEFIJHQUPCM-JMRMDATBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus cereus (ncbitaxon:1396) | - | PubMed (8071129) | Strain: NR2991 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azoxybacilin (CHEBI:65461) has role antifungal agent (CHEBI:35718) |
| azoxybacilin (CHEBI:65461) has role antimicrobial agent (CHEBI:33281) |
| azoxybacilin (CHEBI:65461) has role bacterial metabolite (CHEBI:76969) |
| azoxybacilin (CHEBI:65461) is a azoxy compound (CHEBI:37390) |
| azoxybacilin (CHEBI:65461) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-[(Z)-methyl-NNO-azoxy]butanoic acid |
| Synonym | Source |
|---|---|
| [(3S)-3-amino-4-hydroxy-4-oxobutyl]-(Z)-methylimino-oxidoazanium | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7074303 | Reaxys |
| CAS:157998-96-4 | ChemIDplus |
| Citations |
|---|