EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O6 |
| Net Charge | 0 |
| Average Mass | 250.206 |
| Monoisotopic Mass | 250.04774 |
| SMILES | CC1=C(O)C(=O)c2c(O)c(O)c(C)c(O)c2C1=O |
| InChI | InChI=1S/C12H10O6/c1-3-7(13)5-6(11(17)9(3)15)12(18)10(16)4(2)8(5)14/h13,15-17H,1-2H3 |
| InChIKey | REESKGYZXCEZKQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aureobasidium (ncbitaxon:5579) | - | PubMed (11213290) |
| Roles Classification |
|---|
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aureoquinone (CHEBI:65458) has role antibacterial agent (CHEBI:33282) |
| aureoquinone (CHEBI:65458) has role metabolite (CHEBI:25212) |
| aureoquinone (CHEBI:65458) has role protease inhibitor (CHEBI:37670) |
| aureoquinone (CHEBI:65458) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| aureoquinone (CHEBI:65458) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2,5,7,8-tetrahydroxy-3,6-dimethylnaphthalene-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| DE10349512 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2588151 | Reaxys |
| Citations |
|---|