EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O6 |
| Net Charge | 0 |
| Average Mass | 250.206 |
| Monoisotopic Mass | 250.04774 |
| SMILES | CC1=C(O)C(=O)c2c(O)c(O)c(C)c(O)c2C1=O |
| InChI | InChI=1S/C12H10O6/c1-3-7(13)5-6(11(17)9(3)15)12(18)10(16)4(2)8(5)14/h13,15-17H,1-2H3 |
| InChIKey | REESKGYZXCEZKQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aureobasidium (ncbitaxon:5579) | - | PubMed (11213290) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aureoquinone (CHEBI:65458) has role antibacterial agent (CHEBI:33282) |
| aureoquinone (CHEBI:65458) has role metabolite (CHEBI:25212) |
| aureoquinone (CHEBI:65458) has role protease inhibitor (CHEBI:37670) |
| aureoquinone (CHEBI:65458) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| aureoquinone (CHEBI:65458) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2,5,7,8-tetrahydroxy-3,6-dimethylnaphthalene-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| DE10349512 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2588151 | Reaxys |
| Citations |
|---|