EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O4 |
| Net Charge | 0 |
| Average Mass | 252.310 |
| Monoisotopic Mass | 252.13616 |
| SMILES | [H][C@@]12C=C[C@H](O)[C@]([H])(CC(=O)O[C@@H](C)CCC/C=C/1)O2 |
| InChI | InChI=1S/C14H20O4/c1-10-5-3-2-4-6-11-7-8-12(15)13(18-11)9-14(16)17-10/h4,6-8,10-13,15H,2-3,5,9H2,1H3/b6-4+/t10-,11-,12-,13-/m0/s1 |
| InChIKey | LXBFWPWKVZPNRA-NPZYAQMBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ostianus (ncbitaxon:138279) | - | PubMed (18078344) | Strain: 01F313 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspergillide C (CHEBI:65452) has role Aspergillus metabolite (CHEBI:76956) |
| aspergillide C (CHEBI:65452) has role antineoplastic agent (CHEBI:35610) |
| aspergillide C (CHEBI:65452) is a bridged compound (CHEBI:35990) |
| aspergillide C (CHEBI:65452) is a cyclic ether (CHEBI:37407) |
| aspergillide C (CHEBI:65452) is a macrolide (CHEBI:25106) |
| aspergillide C (CHEBI:65452) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,5S,9E,11S,14S)-14-hydroxy-5-methyl-4,15-dioxabicyclo[9.3.1]pentadeca-9,12-dien-3-one |
| Synonym | Source |
|---|---|
| (+)-asperigillide C | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15805982 | Reaxys |
| Citations |
|---|