EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22O4 |
| Net Charge | 0 |
| Average Mass | 254.326 |
| Monoisotopic Mass | 254.15181 |
| SMILES | [H][C@@]12/C=C/CCC[C@H](C)OC(=O)C[C@]([H])(O1)[C@@H](O)CC2 |
| InChI | InChI=1S/C14H22O4/c1-10-5-3-2-4-6-11-7-8-12(15)13(18-11)9-14(16)17-10/h4,6,10-13,15H,2-3,5,7-9H2,1H3/b6-4+/t10-,11-,12-,13-/m0/s1 |
| InChIKey | FDJDTDDUDZAAFP-NPZYAQMBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ostianus (ncbitaxon:138279) | - | PubMed (1807834) | Strain: 01F313 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspergillide B (CHEBI:65451) has role Aspergillus metabolite (CHEBI:76956) |
| aspergillide B (CHEBI:65451) has role antineoplastic agent (CHEBI:35610) |
| aspergillide B (CHEBI:65451) is a bridged compound (CHEBI:35990) |
| aspergillide B (CHEBI:65451) is a cyclic ether (CHEBI:37407) |
| aspergillide B (CHEBI:65451) is a macrolide (CHEBI:25106) |
| aspergillide B (CHEBI:65451) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,5S,9E,11R,14S)-14-hydroxy-5-methyl-4,15-dioxabicyclo[9.3.1]pentadec-9-en-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15805984 | Reaxys |
| Citations |
|---|