EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H50O13 |
| Net Charge | 0 |
| Average Mass | 786.871 |
| Monoisotopic Mass | 786.32514 |
| SMILES | COc1c(C(O)CC(C)C)ccc(O)c1C(=O)c1c(O)cc(C)cc1C1OC(=O)c2c(ccc(C(CC(C)C)OC(C)=O)c2OC)Oc2c(O)cc(C)cc2C1O |
| InChI | InChI=1S/C44H50O13/c1-20(2)14-30(47)25-10-12-29(46)36(41(25)53-8)39(51)35-27(16-22(5)18-31(35)48)43-38(50)28-17-23(6)19-32(49)40(28)56-33-13-11-26(34(15-21(3)4)55-24(7)45)42(54-9)37(33)44(52)57-43/h10-13,16-21,30,34,38,43,46-50H,14-15H2,1-9H3 |
| InChIKey | XHGXNCJQYFUJOZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium asperosporum (ncbitaxon:70097) | - | PubMed (8119857) | Strain: KY 1635 |
| Roles Classification |
|---|
| Biological Roles: | EC 2.3.1.26 (sterol O-acyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of acyl-CoA:cholesterol acyltransferase (EC 2.3.1.26). Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AS-186d (CHEBI:65447) has role Penicillium metabolite (CHEBI:76964) |
| AS-186d (CHEBI:65447) has role EC 2.3.1.26 (sterol O-acyltransferase) inhibitor (CHEBI:64696) |
| AS-186d (CHEBI:65447) is a acetate ester (CHEBI:47622) |
| AS-186d (CHEBI:65447) is a aromatic ether (CHEBI:35618) |
| AS-186d (CHEBI:65447) is a benzophenones (CHEBI:22726) |
| AS-186d (CHEBI:65447) is a dibenzodioxonine (CHEBI:71155) |
| AS-186d (CHEBI:65447) is a lactone (CHEBI:25000) |
| AS-186d (CHEBI:65447) is a polyphenol (CHEBI:26195) |
| AS-186d (CHEBI:65447) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 1-(8,12-dihydroxy-7-{3-hydroxy-2-[6-hydroxy-3-(1-hydroxy-3-methylbutyl)-2-methoxybenzoyl]-5-methylphenyl}-4-methoxy-10-methyl-5-oxo-7,8-dihydro-5H-dibenzo[b,h][1,5]dioxonin-3-yl)-3-methylbutyl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6840077 | Reaxys |
| Citations |
|---|