EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H46O12 |
| Net Charge | 0 |
| Average Mass | 754.829 |
| Monoisotopic Mass | 754.29893 |
| SMILES | COc1c(C(CC(C)C)OC(C)=O)ccc2c1C(=O)OC(c1cc(C)cc(O)c1C(=O)c1c(O)ccc(CC=C(C)C)c1O)C(O)c1cc(C)cc(O)c1O2 |
| InChI | InChI=1S/C43H46O12/c1-20(2)9-10-25-11-13-29(45)35(37(25)48)39(50)34-27(16-22(5)18-30(34)46)42-38(49)28-17-23(6)19-31(47)40(28)54-32-14-12-26(33(15-21(3)4)53-24(7)44)41(52-8)36(32)43(51)55-42/h9,11-14,16-19,21,33,38,42,45-49H,10,15H2,1-8H3 |
| InChIKey | MQLUFEFCCDNPMA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium asperosporum (ncbitaxon:70097) | - | PubMed (8119857) | Strain: KY 1635 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 2.3.1.26 (sterol O-acyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of acyl-CoA:cholesterol acyltransferase (EC 2.3.1.26). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AS-186g (CHEBI:65446) has role Penicillium metabolite (CHEBI:76964) |
| AS-186g (CHEBI:65446) has role antimicrobial agent (CHEBI:33281) |
| AS-186g (CHEBI:65446) has role EC 2.3.1.26 (sterol O-acyltransferase) inhibitor (CHEBI:64696) |
| AS-186g (CHEBI:65446) is a acetate ester (CHEBI:47622) |
| AS-186g (CHEBI:65446) is a aromatic ether (CHEBI:35618) |
| AS-186g (CHEBI:65446) is a benzophenones (CHEBI:22726) |
| AS-186g (CHEBI:65446) is a dibenzodioxonine (CHEBI:71155) |
| AS-186g (CHEBI:65446) is a lactone (CHEBI:25000) |
| AS-186g (CHEBI:65446) is a polyphenol (CHEBI:26195) |
| Citations |
|---|