EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O7 |
| Net Charge | 0 |
| Average Mass | 368.341 |
| Monoisotopic Mass | 368.08960 |
| SMILES | CC1(C)Oc2c(O)cc(O)c3c2C1Cc1c-3oc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C20H16O7/c1-20(2)9-5-8-17(25)15-10(22)3-7(21)4-13(15)26-18(8)16-11(23)6-12(24)19(27-20)14(9)16/h3-4,6,9,21-24H,5H2,1-2H3 |
| InChIKey | SISHCMQQUDFHIG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artocarpus lanceifolius (ncbitaxon:709049) | bark (BTO:0001301) | PubMed (12490227) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| artoindonesianin P (CHEBI:65442) has role antineoplastic agent (CHEBI:35610) |
| artoindonesianin P (CHEBI:65442) has role metabolite (CHEBI:25212) |
| artoindonesianin P (CHEBI:65442) is a extended flavonoid (CHEBI:71037) |
| artoindonesianin P (CHEBI:65442) is a organic heteropentacyclic compound (CHEBI:38164) |
| artoindonesianin P (CHEBI:65442) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 1,3,8,10-tetrahydroxy-5,5-dimethyl-5a,6-dihydro-5H,7H-[1]benzofuro[3,4-bc]xanthen-7-one |
| Synonym | Source |
|---|---|
| O,O'-didemethylartonin L | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMPK12111519 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9304200 | Reaxys |
| Citations |
|---|