EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26O6 |
| Net Charge | 0 |
| Average Mass | 434.488 |
| Monoisotopic Mass | 434.17294 |
| SMILES | C=C(C)C1Cc2c(oc3cc(OC)c(/C=C/C(C)C)c(O)c3c2=O)-c2ccc(O)cc2O1 |
| InChI | InChI=1S/C26H26O6/c1-13(2)6-8-16-20(30-5)12-22-23(24(16)28)25(29)18-11-19(14(3)4)31-21-10-15(27)7-9-17(21)26(18)32-22/h6-10,12-13,19,27-28H,3,11H2,1-2,4-5H3/b8-6+ |
| InChIKey | KULOJVAPXYSRNQ-SOFGYWHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artocarpus elasticus (ncbitaxon:709042) | xylem (BTO:0001468) | PubMed (19280147) | Previous component: wood; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| artoindonesianin E1 (CHEBI:65441) has role antineoplastic agent (CHEBI:35610) |
| artoindonesianin E1 (CHEBI:65441) has role metabolite (CHEBI:25212) |
| artoindonesianin E1 (CHEBI:65441) is a aromatic ether (CHEBI:35618) |
| artoindonesianin E1 (CHEBI:65441) is a extended flavonoid (CHEBI:71037) |
| artoindonesianin E1 (CHEBI:65441) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| 3,9-dihydroxy-11-methoxy-10-[(1E)-3-methylbut-1-en-1-yl]-6-(prop-1-en-2-yl)-6,7-dihydro-8H-chromeno[3,2-d][1]benzoxepin-8-one |
| Citations |
|---|