EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O6 |
| Net Charge | 0 |
| Average Mass | 352.342 |
| Monoisotopic Mass | 352.09469 |
| SMILES | CC1(C)C=Cc2c(cc(O)c3c(=O)cc(-c4ccc(O)c(O)c4)oc23)O1 |
| InChI | InChI=1S/C20H16O6/c1-20(2)6-5-11-17(26-20)9-15(24)18-14(23)8-16(25-19(11)18)10-3-4-12(21)13(22)7-10/h3-9,21-22,24H,1-2H3 |
| InChIKey | QNSVTPUDNHNRQZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artocarpus chama (ncbitaxon:709040) | root (BTO:0001188) | PubMed (15165133) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| artochamin C (CHEBI:65440) has role antineoplastic agent (CHEBI:35610) |
| artochamin C (CHEBI:65440) has role metabolite (CHEBI:25212) |
| artochamin C (CHEBI:65440) is a extended flavonoid (CHEBI:71037) |
| artochamin C (CHEBI:65440) is a pyranochromane (CHEBI:74632) |
| artochamin C (CHEBI:65440) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-4H,8H-pyrano[2,3-f]chromen-4-one |
| Synonym | Source |
|---|---|
| 5-hydroxy-8,8-dimethyl-2-(3,4-dihydroxyphenyl)-4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10031179 | Reaxys |
| Citations |
|---|