EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O6 |
| Net Charge | 0 |
| Average Mass | 436.504 |
| Monoisotopic Mass | 436.18859 |
| SMILES | COc1cc2oc(-c3ccc(O)cc3O)c(CC=C(C)C)c(=O)c2c(O)c1/C=C/C(C)C |
| InChI | InChI=1S/C26H28O6/c1-14(2)6-9-18-21(31-5)13-22-23(24(18)29)25(30)19(10-7-15(3)4)26(32-22)17-11-8-16(27)12-20(17)28/h6-9,11-14,27-29H,10H2,1-5H3/b9-6+ |
| InChIKey | KRGDFVQWQJIMEK-RMKNXTFCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artocarpus (ncbitaxon:3488) | xylem (BTO:0001468) | Article (J SCI IND RES,1956,15B,183) | Previous component: wood; |
| Artocarpus heterophyllus (ncbitaxon:3489) | root (BTO:0001188) | DOI (10.1016/0031-9422(95)00135-T) | |
| Artocarpus chama (ncbitaxon:709040) | root (BTO:0001188) | PubMed (15165133) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| artocarpin (CHEBI:65439) has role antineoplastic agent (CHEBI:35610) |
| artocarpin (CHEBI:65439) has role metabolite (CHEBI:25212) |
| artocarpin (CHEBI:65439) is a monomethoxyflavone (CHEBI:25401) |
| artocarpin (CHEBI:65439) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 2-(2,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-[(1E)-3-methylbut-1-en-1-yl]-3-(3-methylbut-2-en-1-yl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5-hydroxy-7-methoxy-3-(3-methyl-2-butenyl)-6-(3-methyl-1-butenyl)-2-(2,4-dihydroxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| 2',4',5-trihydroxy-7-methoxy-6-(3-methyl-1-butenyl)-3-(3-methyl-2-butenyl)flavone | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMPK12110898 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:62644 | Reaxys |
| Citations |
|---|