EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32O6 |
| Net Charge | 0 |
| Average Mass | 452.547 |
| Monoisotopic Mass | 452.21989 |
| SMILES | [H][C@]12Cc3c(cc(-c4ccc(OC)cc4)oc3=O)O[C@]1(C)CC[C@@]1(O)C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C27H32O6/c1-24(2)22(28)10-11-25(3)21-14-18-20(33-26(21,4)12-13-27(24,25)30)15-19(32-23(18)29)16-6-8-17(31-5)9-7-16/h6-9,15,21,30H,10-14H2,1-5H3/t21-,25-,26-,27-/m1/s1 |
| InChIKey | XKDGQMPLQPRTCS-HHPVDLARSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (10724008) | UV irradiation induced mutant of Penicillium FO4259 Strain: FO 4259-11 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arisugacin C (CHEBI:65437) has role Penicillium metabolite (CHEBI:76964) |
| arisugacin C (CHEBI:65437) has role antimicrobial agent (CHEBI:33281) |
| arisugacin C (CHEBI:65437) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| arisugacin C (CHEBI:65437) is a aromatic ether (CHEBI:35618) |
| arisugacin C (CHEBI:65437) is a cyclic ketone (CHEBI:3992) |
| arisugacin C (CHEBI:65437) is a organic heterotetracyclic compound (CHEBI:38163) |
| arisugacin C (CHEBI:65437) is a tertiary alcohol (CHEBI:26878) |
| arisugacin C (CHEBI:65437) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4aS,6aR,12aR,12bR)-4a-hydroxy-9-(4-methoxyphenyl)-4,4,6a,12b-tetramethyl-1,4a,5,6,6a,12,12a,12b-octahydro-2H,11H-benzo[f]pyrano[4,3-b]chromene-3,11(4H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8521391 | Reaxys |
| Citations |
|---|