EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O7 |
| Net Charge | 0 |
| Average Mass | 466.530 |
| Monoisotopic Mass | 466.19915 |
| SMILES | COc1ccc(-c2cc3c(c(=O)o2)C[C@]2(O)[C@@]4(C)C(=O)C=CC(C)(C)[C@]4(O)CC[C@@]2(C)O3)cc1 |
| InChI | InChI=1S/C27H30O7/c1-23(2)11-10-21(28)25(4)26(23,30)13-12-24(3)27(25,31)15-18-20(34-24)14-19(33-22(18)29)16-6-8-17(32-5)9-7-16/h6-11,14,30-31H,12-13,15H2,1-5H3/t24-,25+,26-,27-/m1/s1 |
| InChIKey | FNHNBWWIASUEQH-HVWQDESWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (7649881) | Strain: FO 4259 |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arisugacin B (CHEBI:65436) has role Penicillium metabolite (CHEBI:76964) |
| arisugacin B (CHEBI:65436) has role antimicrobial agent (CHEBI:33281) |
| arisugacin B (CHEBI:65436) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| arisugacin B (CHEBI:65436) is a aromatic ether (CHEBI:35618) |
| arisugacin B (CHEBI:65436) is a enone (CHEBI:51689) |
| arisugacin B (CHEBI:65436) is a organic heterotetracyclic compound (CHEBI:38163) |
| arisugacin B (CHEBI:65436) is a tertiary alcohol (CHEBI:26878) |
| arisugacin B (CHEBI:65436) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4aR,6aR,12aS,12bS)-4a,12a-dihydroxy-9-(4-methoxyphenyl)-4,4,6a,12b-tetramethyl-4a,6,6a,12,12a,12b-hexahydro-4H,11H-benzo[f]pyrano[4,3-b]chromene-1,11(5H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7629746 | Reaxys |
| Citations |
|---|