EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O7 |
| Net Charge | 0 |
| Average Mass | 466.530 |
| Monoisotopic Mass | 466.19915 |
| SMILES | COc1ccc(-c2cc3c(c(=O)o2)C[C@]2(O)[C@@]4(C)C(=O)C=CC(C)(C)[C@]4(O)CC[C@@]2(C)O3)cc1 |
| InChI | InChI=1S/C27H30O7/c1-23(2)11-10-21(28)25(4)26(23,30)13-12-24(3)27(25,31)15-18-20(34-24)14-19(33-22(18)29)16-6-8-17(32-5)9-7-16/h6-11,14,30-31H,12-13,15H2,1-5H3/t24-,25+,26-,27-/m1/s1 |
| InChIKey | FNHNBWWIASUEQH-HVWQDESWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (7649881) | Strain: FO 4259 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arisugacin B (CHEBI:65436) has role Penicillium metabolite (CHEBI:76964) |
| arisugacin B (CHEBI:65436) has role antimicrobial agent (CHEBI:33281) |
| arisugacin B (CHEBI:65436) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| arisugacin B (CHEBI:65436) is a aromatic ether (CHEBI:35618) |
| arisugacin B (CHEBI:65436) is a enone (CHEBI:51689) |
| arisugacin B (CHEBI:65436) is a organic heterotetracyclic compound (CHEBI:38163) |
| arisugacin B (CHEBI:65436) is a tertiary alcohol (CHEBI:26878) |
| arisugacin B (CHEBI:65436) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4aR,6aR,12aS,12bS)-4a,12a-dihydroxy-9-(4-methoxyphenyl)-4,4,6a,12b-tetramethyl-4a,6,6a,12,12a,12b-hexahydro-4H,11H-benzo[f]pyrano[4,3-b]chromene-1,11(5H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7629746 | Reaxys |
| Citations |
|---|