EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O8 |
| Net Charge | 0 |
| Average Mass | 496.556 |
| Monoisotopic Mass | 496.20972 |
| SMILES | COc1ccc(-c2cc3c(c(=O)o2)C[C@]2(O)[C@@]4(C)C(=O)C=CC(C)(C)[C@]4(O)CC[C@@]2(C)O3)cc1OC |
| InChI | InChI=1S/C28H32O8/c1-24(2)10-9-22(29)26(4)27(24,31)12-11-25(3)28(26,32)15-17-20(36-25)14-19(35-23(17)30)16-7-8-18(33-5)21(13-16)34-6/h7-10,13-14,31-32H,11-12,15H2,1-6H3/t25-,26+,27-,28-/m1/s1 |
| InChIKey | MIHBCQWIBJDVPX-JUDWXZBOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (7649881) | Strain: FO 4259 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arisugacin A (CHEBI:65435) has role Penicillium metabolite (CHEBI:76964) |
| arisugacin A (CHEBI:65435) has role antimicrobial agent (CHEBI:33281) |
| arisugacin A (CHEBI:65435) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| arisugacin A (CHEBI:65435) has role metabolite (CHEBI:25212) |
| arisugacin A (CHEBI:65435) is a aromatic ether (CHEBI:35618) |
| arisugacin A (CHEBI:65435) is a enone (CHEBI:51689) |
| arisugacin A (CHEBI:65435) is a organic heterotetracyclic compound (CHEBI:38163) |
| arisugacin A (CHEBI:65435) is a tertiary alcohol (CHEBI:26878) |
| arisugacin A (CHEBI:65435) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4aR,6aR,12aS,12bS)-9-(3,4-dimethoxyphenyl)-4a,12a-dihydroxy-4,4,6a,12b-tetramethyl-4a,6,6a,12,12a,12b-hexahydro-4H,11H-benzo[f]pyrano[4,3-b]chromene-1,11(5H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7450892 | Reaxys |
| Citations |
|---|