EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H57N5O7 |
| Net Charge | 0 |
| Average Mass | 671.880 |
| Monoisotopic Mass | 671.42580 |
| SMILES | CCCCCC[C@H](C)[C@@H]1CC(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C36H57N5O7/c1-8-9-10-12-15-24(6)29-20-30(42)37-21-31(43)41-32(23(4)5)35(46)39-27(18-22(2)3)34(45)38-25(7)33(44)40-28(36(47)48-29)19-26-16-13-11-14-17-26/h11,13-14,16-17,22-25,27-29,32H,8-10,12,15,18-21H2,1-7H3,(H,37,42)(H,38,45)(H,39,46)(H,40,44)(H,41,43)/t24-,25-,27-,28-,29-,32-/m0/s1 |
| InChIKey | HQEBGENSMXBRMP-GZMZQGJJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salinispora arenicola (ncbitaxon:168697) | - | PubMed (19117399) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arenamide A (CHEBI:65433) has functional parent (3S,4S)-3-hydroxy-4-methyldecanoic acid (CHEBI:71005) |
| arenamide A (CHEBI:65433) has role antineoplastic agent (CHEBI:35610) |
| arenamide A (CHEBI:65433) has role metabolite (CHEBI:25212) |
| arenamide A (CHEBI:65433) is a cyclodepsipeptide (CHEBI:35213) |
| arenamide A (CHEBI:65433) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (3S,6S,9S,12S,19S)-3-benzyl-6-methyl-9-(2-methylpropyl)-19-[(2S)-octan-2-yl]-12-(propan-2-yl)-1-oxa-4,7,10,13,16-pentaazacyclononadecane-2,5,8,11,14,17-hexone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19756158 | Reaxys |
| Citations |
|---|