EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38O4 |
| Net Charge | 0 |
| Average Mass | 378.553 |
| Monoisotopic Mass | 378.27701 |
| SMILES | CCCCCCCCCCCCCCCc1cc(O)cc(O)c1OC(C)=O |
| InChI | InChI=1S/C23H38O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-17-21(25)18-22(26)23(20)27-19(2)24/h17-18,25-26H,3-16H2,1-2H3 |
| InChIKey | DHSHIDBWARFSDH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ardisia colorata (ncbitaxon:1009002) | fruit (BTO:0000486) | PubMed (11767097) | Dried fruit |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ardisiphenol A (CHEBI:65430) has functional parent 6-pentadecylbenzene-1,2,4-triol (CHEBI:70993) |
| ardisiphenol A (CHEBI:65430) has role antineoplastic agent (CHEBI:35610) |
| ardisiphenol A (CHEBI:65430) has role metabolite (CHEBI:25212) |
| ardisiphenol A (CHEBI:65430) has role radical scavenger (CHEBI:48578) |
| ardisiphenol A (CHEBI:65430) is a acetate ester (CHEBI:47622) |
| ardisiphenol A (CHEBI:65430) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-6-pentadecylphenyl acetate |
| Synonym | Source |
|---|---|
| 6-pentadecyl-1,2,4-trihydroxybenzene-1-O-acetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9091373 | Reaxys |
| Citations |
|---|