EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O5 |
| Net Charge | 0 |
| Average Mass | 302.326 |
| Monoisotopic Mass | 302.11542 |
| SMILES | COc1cc(OC)c2c(c1)OCC(c1ccc(O)cc1O)C2 |
| InChI | InChI=1S/C17H18O5/c1-20-12-7-16(21-2)14-5-10(9-22-17(14)8-12)13-4-3-11(18)6-15(13)19/h3-4,6-8,10,18-19H,5,9H2,1-2H3 |
| InChIKey | ITRZCICEVGLQFO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lotisoflavan (CHEBI:6543) has functional parent isoflavan (CHEBI:38740) |
| lotisoflavan (CHEBI:6543) has role plant metabolite (CHEBI:76924) |
| lotisoflavan (CHEBI:6543) is a hydroxyisoflavans (CHEBI:76250) |
| lotisoflavan (CHEBI:6543) is a methoxyisoflavan (CHEBI:77002) |
| IUPAC Name |
|---|
| 4-(5,7-dimethoxy-3,4-dihydro-2H-1-benzopyran-3-yl)benzene-1,3-diol |
| Synonym | Source |
|---|---|
| 2',4'-dihydroxy-5,7-dimethoxyisoflavan | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00002544 | KNApSAcK |
| C10495 | KEGG COMPOUND |
| LMPK12080048 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6982121 | Reaxys |
| CAS:77370-02-6 | KEGG COMPOUND |