EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H40O26 |
| Net Charge | 0 |
| Average Mass | 960.756 |
| Monoisotopic Mass | 960.18078 |
| SMILES | [H][C@@]1(c2cc3c(c(O)c2OC)OC(=O)c2cc([C@]4([H])O[C@H](COC(=O)c5cc(O)c(O)c(O)c5)[C@@H](O)[C@H](O)[C@H]4O)c(OC)c(O)c2OC3=O)O[C@H](COC(=O)c2cc(O)c(O)c(O)c2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C42H40O26/c1-61-33-13(35-29(53)27(51)25(49)21(65-35)9-63-39(57)11-3-17(43)23(47)18(44)4-11)7-15-37(31(33)55)67-42(60)16-8-14(34(62-2)32(56)38(16)68-41(15)59)36-30(54)28(52)26(50)22(66-36)10-64-40(58)12-5-19(45)24(48)20(46)6-12/h3-8,21-22,25-30,35-36,43-56H,9-10H2,1-2H3/t21-,22-,25-,26-,27+,28+,29-,30-,35+,36+/m1/s1 |
| InChIKey | DXKGWDISVOGUDQ-XHWFIBSOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ardisia japonica (ncbitaxon:276775) | whole plant (BTO:0001461) | PubMed (17397219) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.26.13 (retroviral ribonuclease H) inhibitor An inhibitor of ribonuclease H (EC 3.1.26.13), an enzyme required for specific hydrolysis of the RNA strand of an RNA/DNA hybrid. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ardimerin digallate (CHEBI:65423) has role EC 3.1.26.13 (retroviral ribonuclease H) inhibitor (CHEBI:52629) |
| ardimerin digallate (CHEBI:65423) has role metabolite (CHEBI:25212) |
| ardimerin digallate (CHEBI:65423) is a C-glycosyl compound (CHEBI:20857) |
| ardimerin digallate (CHEBI:65423) is a aromatic ether (CHEBI:35618) |
| ardimerin digallate (CHEBI:65423) is a gallate ester (CHEBI:37576) |
| ardimerin digallate (CHEBI:65423) is a lactone (CHEBI:25000) |
| Synonym | Source |
|---|---|
| ardimerin 6,6'-digallate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11199123 | Reaxys |
| Citations |
|---|