EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H40O26 |
| Net Charge | 0 |
| Average Mass | 960.756 |
| Monoisotopic Mass | 960.18078 |
| SMILES | [H][C@@]1(c2cc3c(c(O)c2OC)OC(=O)c2cc([C@]4([H])O[C@H](COC(=O)c5cc(O)c(O)c(O)c5)[C@@H](O)[C@H](O)[C@H]4O)c(OC)c(O)c2OC3=O)O[C@H](COC(=O)c2cc(O)c(O)c(O)c2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C42H40O26/c1-61-33-13(35-29(53)27(51)25(49)21(65-35)9-63-39(57)11-3-17(43)23(47)18(44)4-11)7-15-37(31(33)55)67-42(60)16-8-14(34(62-2)32(56)38(16)68-41(15)59)36-30(54)28(52)26(50)22(66-36)10-64-40(58)12-5-19(45)24(48)20(46)6-12/h3-8,21-22,25-30,35-36,43-56H,9-10H2,1-2H3/t21-,22-,25-,26-,27+,28+,29-,30-,35+,36+/m1/s1 |
| InChIKey | DXKGWDISVOGUDQ-XHWFIBSOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ardisia japonica (ncbitaxon:276775) | whole plant (BTO:0001461) | PubMed (17397219) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.26.13 (retroviral ribonuclease H) inhibitor An inhibitor of ribonuclease H (EC 3.1.26.13), an enzyme required for specific hydrolysis of the RNA strand of an RNA/DNA hybrid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ardimerin digallate (CHEBI:65423) has role EC 3.1.26.13 (retroviral ribonuclease H) inhibitor (CHEBI:52629) |
| ardimerin digallate (CHEBI:65423) has role metabolite (CHEBI:25212) |
| ardimerin digallate (CHEBI:65423) is a C-glycosyl compound (CHEBI:20857) |
| ardimerin digallate (CHEBI:65423) is a aromatic ether (CHEBI:35618) |
| ardimerin digallate (CHEBI:65423) is a gallate ester (CHEBI:37576) |
| ardimerin digallate (CHEBI:65423) is a lactone (CHEBI:25000) |
| Synonym | Source |
|---|---|
| ardimerin 6,6'-digallate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11199123 | Reaxys |
| Citations |
|---|