EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H65N5O7S |
| Net Charge | 0 |
| Average Mass | 796.088 |
| Monoisotopic Mass | 795.46047 |
| SMILES | CC[C@H](C)[C@H]1C(=O)N2CCC[C@H]2C(=O)O[C@H](C(C)(C)C)C[C@@H](C)C/C=C\C2=N[C@@H](CCC(=O)N[C@@H](Cc3ccc(OC)cc3)C(=O)N(C)[C@@H](C)C(=O)N1C)CS2 |
| InChI | InChI=1S/C43H65N5O7S/c1-11-28(3)38-41(52)48-23-13-15-34(48)42(53)55-35(43(5,6)7)24-27(2)14-12-16-37-44-31(26-56-37)19-22-36(49)45-33(25-30-17-20-32(54-10)21-18-30)40(51)46(8)29(4)39(50)47(38)9/h12,16-18,20-21,27-29,31,33-35,38H,11,13-15,19,22-26H2,1-10H3,(H,45,49)/b16-12-/t27-,28-,29-,31-,33-,34-,35-,38-/m0/s1 |
| InChIKey | RDPZVJUUVDDQSB-SXNBFALNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya bouillonii (ncbitaxon:207920) | - | PubMed (18461997) | Strain: PS372 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apratoxin E (CHEBI:65422) has role antineoplastic agent (CHEBI:35610) |
| apratoxin E (CHEBI:65422) has role metabolite (CHEBI:25212) |
| apratoxin E (CHEBI:65422) is a apratoxin (CHEBI:35214) |
| IUPAC Name |
|---|
| (3S,5S,7Z,12S,17S,20S,23S,28aS)-23-[(2S)-butan-2-yl]-3-tert-butyl-17-(4-methoxybenzyl)-5,19,20,22-tetramethyl-3,4,5,6,11,12,13,14,16,17,19,20,22,23,26,27,28,28a-octadecahydro-1H-12,9-(azeno)pyrrolo[2,1-c][1,19,4,7,10,13]oxathiatetraazacyclohexacosine-1,15,18,21,24-pentone |