EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40O5 |
| Net Charge | 0 |
| Average Mass | 420.590 |
| Monoisotopic Mass | 420.28757 |
| SMILES | C/C(=C\CC/C(=C/CC1OC(=O)C=C1CO)CO)CC[C@H]1C(C)(C)CCC[C@]1(C)O |
| InChI | InChI=1S/C25H40O5/c1-18(9-12-22-24(2,3)13-6-14-25(22,4)29)7-5-8-19(16-26)10-11-21-20(17-27)15-23(28)30-21/h7,10,15,21-22,26-27,29H,5-6,8-9,11-14,16-17H2,1-4H3/b18-7+,19-10-/t21?,22-,25-/m0/s1 |
| InChIKey | BYAXMGMKQCMKDN-MWOZSAKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aplysinopsis digitata (WORMS:190040) | - | PubMed (18461996) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aplysinoplide C (CHEBI:65420) has role antineoplastic agent (CHEBI:35610) |
| aplysinoplide C (CHEBI:65420) has role metabolite (CHEBI:25212) |
| aplysinoplide C (CHEBI:65420) is a butenolide (CHEBI:50523) |
| aplysinoplide C (CHEBI:65420) is a primary alcohol (CHEBI:15734) |
| aplysinoplide C (CHEBI:65420) is a sesterterpenoid (CHEBI:26660) |
| aplysinoplide C (CHEBI:65420) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 4-(hydroxymethyl)-5-{(2Z,6E)-3-(hydroxymethyl)-9-[(1S,2S)-2-hydroxy-2,6,6-trimethylcyclohexyl]-7-methylnona-2,6-dien-1-yl}furan-2(5H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18836366 | Reaxys |
| Citations |
|---|