EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O4 |
| Net Charge | 0 |
| Average Mass | 400.559 |
| Monoisotopic Mass | 400.26136 |
| SMILES | CC1=C(CC/C(C)=C/CC/C(=C\C=C\C2=CC(=O)OC2O)CO)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H36O4/c1-18(13-14-22-19(2)9-7-15-25(22,3)4)8-5-10-20(17-26)11-6-12-21-16-23(27)29-24(21)28/h6,8,11-12,16,24,26,28H,5,7,9-10,13-15,17H2,1-4H3/b12-6+,18-8+,20-11+ |
| InChIKey | IXZLFRIHNOJYGA-QGBXNASSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aplysinopsis digitata (WORMS:190040) | - | PubMed (18461996) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aplysinoplide A (CHEBI:65418) has role antineoplastic agent (CHEBI:35610) |
| aplysinoplide A (CHEBI:65418) has role metabolite (CHEBI:25212) |
| aplysinoplide A (CHEBI:65418) is a butenolide (CHEBI:50523) |
| aplysinoplide A (CHEBI:65418) is a primary alcohol (CHEBI:15734) |
| aplysinoplide A (CHEBI:65418) is a secondary alcohol (CHEBI:35681) |
| aplysinoplide A (CHEBI:65418) is a sesterterpenoid (CHEBI:26660) |
| IUPAC Name |
|---|
| 5-hydroxy-4-[(1E,3E,7E)-4-(hydroxymethyl)-8-methyl-10-(2,6,6-trimethylcyclohex-1-en-1-yl)deca-1,3,7-trien-1-yl]furan-2(5H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18836364 | Reaxys |
| Citations |
|---|