EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24Br4N4O8 |
| Net Charge | 0 |
| Average Mass | 804.081 |
| Monoisotopic Mass | 799.83276 |
| SMILES | COC1=C(Br)[C@H](O)[C@@]2(C=C1Br)CC(C(=O)NCCCCNC(=O)C1=NO[C@@]3(C=C(Br)C(=O)[C@H](Br)[C@H]3O)C1)=NO2 |
| InChI | InChI=1S/C23H24Br4N4O8/c1-37-17-11(25)7-23(19(34)15(17)27)9-13(31-39-23)21(36)29-5-3-2-4-28-20(35)12-8-22(38-30-12)6-10(24)16(32)14(26)18(22)33/h6-7,14,18-19,33-34H,2-5,8-9H2,1H3,(H,28,35)(H,29,36)/t14-,18+,19-,22-,23+/m0/s1 |
| InChIKey | ONDRQQMSEBCZNC-XXYODPDXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aplysinella (ncbitaxon:283412) | - | PubMed (18401846) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-aplysinillin (CHEBI:65417) has functional parent N-substituted putrescine (CHEBI:26406) |
| (+)-aplysinillin (CHEBI:65417) has role antineoplastic agent (CHEBI:35610) |
| (+)-aplysinillin (CHEBI:65417) has role marine metabolite (CHEBI:76507) |
| (+)-aplysinillin (CHEBI:65417) is a alkaloid (CHEBI:22315) |
| (+)-aplysinillin (CHEBI:65417) is a ether (CHEBI:25698) |
| (+)-aplysinillin (CHEBI:65417) is a methylium (CHEBI:29437) |
| (+)-aplysinillin (CHEBI:65417) is a monocarboxylic acid amide (CHEBI:29347) |
| (+)-aplysinillin (CHEBI:65417) is a secondary alcohol (CHEBI:35681) |
| (+)-aplysinillin (CHEBI:65417) is a spiro compound (CHEBI:33599) |
| (+)-aplysinillin (CHEBI:65417) is a α-bromoketone (CHEBI:51843) |
| IUPAC Name |
|---|
| (5S,10R)-7,9-dibromo-N-[4-({[(5R,9R,10S)-7,9-dibromo-10-hydroxy-8-oxo-1-oxa-2-azaspiro[4.5]deca-2,6-dien-3-yl]carbonyl}amino)butyl]-10-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,6,8-triene-3-carboxamide |
| Citations |
|---|