EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H38O4 |
| Net Charge | 0 |
| Average Mass | 390.564 |
| Monoisotopic Mass | 390.27701 |
| SMILES | COC1=C(OC)[C@H](O)[C@H](C/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@@H](C)C1=O |
| InChI | InChI=1S/C24H38O4/c1-16(2)10-8-11-17(3)12-9-13-18(4)14-15-20-19(5)21(25)23(27-6)24(28-7)22(20)26/h10,12,14,19-20,22,26H,8-9,11,13,15H2,1-7H3/b17-12+,18-14+/t19-,20-,22-/m1/s1 |
| InChIKey | LJTSIMVOOOLKOL-FNRDIUJOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | mycelium (BTO:0001436) | PubMed (17932820) | Fermented Mycelium |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antroquinonol (CHEBI:65415) has role antineoplastic agent (CHEBI:35610) |
| antroquinonol (CHEBI:65415) has role fungal metabolite (CHEBI:76946) |
| antroquinonol (CHEBI:65415) is a enol ether (CHEBI:47985) |
| antroquinonol (CHEBI:65415) is a enone (CHEBI:51689) |
| antroquinonol (CHEBI:65415) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (4R,5R,6R)-4-hydroxy-2,3-dimethoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]cyclohex-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11257757 | Reaxys |
| Citations |
|---|