EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O3 |
| Net Charge | 0 |
| Average Mass | 246.306 |
| Monoisotopic Mass | 246.12559 |
| SMILES | C=C(C)C#Cc1c(OC)cc(OC)c(OC)c1C |
| InChI | InChI=1S/C15H18O3/c1-10(2)7-8-12-11(3)15(18-6)14(17-5)9-13(12)16-4/h9H,1H2,2-6H3 |
| InChIKey | CPPLWBNAWKMJON-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | - | PubMed (17559265) | Parasitic fungi on fruiting body of Cinnamomum kanehirai |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antrocapmphin A (CHEBI:65414) has role anti-inflammatory agent (CHEBI:67079) |
| antrocapmphin A (CHEBI:65414) has role metabolite (CHEBI:25212) |
| antrocapmphin A (CHEBI:65414) is a methoxybenzenes (CHEBI:51683) |
| IUPAC Name |
|---|
| 1,2,5-trimethoxy-3-methyl-4-(3-methylbut-3-en-1-yn-1-yl)benzene |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11184575 | Reaxys |
| Citations |
|---|