EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H34N2O9 |
| Net Charge | 0 |
| Average Mass | 554.596 |
| Monoisotopic Mass | 554.22643 |
| SMILES | [H]C(=O)Nc1cccc(C(=O)NC2C(=O)OC(C)C(OC(=O)Cc3ccccc3)C(CCCC)C(=O)OC2C)c1O |
| InChI | InChI=1S/C29H34N2O9/c1-4-5-12-21-26(40-23(33)15-19-10-7-6-8-11-19)18(3)39-29(37)24(17(2)38-28(21)36)31-27(35)20-13-9-14-22(25(20)34)30-16-32/h6-11,13-14,16-18,21,24,26,34H,4-5,12,15H2,1-3H3,(H,30,32)(H,31,35) |
| InChIKey | NAEDADOYRYAJDM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (15813185) | Strain: K01-0031 |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antimycin A9 (CHEBI:65413) has functional parent phenylacetic acid (CHEBI:30745) |
| antimycin A9 (CHEBI:65413) has role antimicrobial agent (CHEBI:33281) |
| antimycin A9 (CHEBI:65413) has role metabolite (CHEBI:25212) |
| antimycin A9 (CHEBI:65413) has role nematicide (CHEBI:25491) |
| antimycin A9 (CHEBI:65413) is a benzamides (CHEBI:22702) |
| antimycin A9 (CHEBI:65413) is a formamides (CHEBI:24079) |
| antimycin A9 (CHEBI:65413) is a macrodiolide (CHEBI:145556) |
| antimycin A9 (CHEBI:65413) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 8-butyl-3-{[3-formamido-2-hydroxybenzoyl]amino}-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl phenylacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21457547 | Reaxys |
| Citations |
|---|