EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H34N2O9 |
| Net Charge | 0 |
| Average Mass | 554.596 |
| Monoisotopic Mass | 554.22643 |
| SMILES | [H]C(=O)Nc1cccc(C(=O)NC2C(=O)OC(C)C(OC(=O)Cc3ccccc3)C(CCCC)C(=O)OC2C)c1O |
| InChI | InChI=1S/C29H34N2O9/c1-4-5-12-21-26(40-23(33)15-19-10-7-6-8-11-19)18(3)39-29(37)24(17(2)38-28(21)36)31-27(35)20-13-9-14-22(25(20)34)30-16-32/h6-11,13-14,16-18,21,24,26,34H,4-5,12,15H2,1-3H3,(H,30,32)(H,31,35) |
| InChIKey | NAEDADOYRYAJDM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (15813185) | Strain: K01-0031 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antimycin A9 (CHEBI:65413) has functional parent phenylacetic acid (CHEBI:30745) |
| antimycin A9 (CHEBI:65413) has role antimicrobial agent (CHEBI:33281) |
| antimycin A9 (CHEBI:65413) has role metabolite (CHEBI:25212) |
| antimycin A9 (CHEBI:65413) has role nematicide (CHEBI:25491) |
| antimycin A9 (CHEBI:65413) is a benzamides (CHEBI:22702) |
| antimycin A9 (CHEBI:65413) is a formamides (CHEBI:24079) |
| antimycin A9 (CHEBI:65413) is a macrodiolide (CHEBI:145556) |
| antimycin A9 (CHEBI:65413) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 8-butyl-3-{[3-formamido-2-hydroxybenzoyl]amino}-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl phenylacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21457547 | Reaxys |
| Citations |
|---|