EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33NO7 |
| Net Charge | 0 |
| Average Mass | 471.550 |
| Monoisotopic Mass | 471.22570 |
| SMILES | [H][C@]1(O[C@@H]2c3cc(O)cc4c3O[C@]([H])(/C(C)=C/C(=C/C)C(=O)C(C)C(=O)N4)[C@H]2C)CC[C@@H](O)[C@@H](C)O1 |
| InChI | InChI=1S/C26H33NO7/c1-6-16-9-12(2)23-14(4)24(33-21-8-7-20(29)15(5)32-21)18-10-17(28)11-19(25(18)34-23)27-26(31)13(3)22(16)30/h6,9-11,13-15,20-21,23-24,28-29H,7-8H2,1-5H3,(H,27,31)/b12-9+,16-6-/t13?,14-,15-,20-,21+,23-,24+/m1/s1 |
| InChIKey | JSYTVJCZLSFGTM-HNLRCUENSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (18776684) | Strain: USF 4727 |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ansaetherone (CHEBI:65412) has role metabolite (CHEBI:25212) |
| ansaetherone (CHEBI:65412) has role radical scavenger (CHEBI:48578) |
| ansaetherone (CHEBI:65412) is a glycoside (CHEBI:24400) |
| ansaetherone (CHEBI:65412) is a lactam (CHEBI:24995) |
| ansaetherone (CHEBI:65412) is a macrocycle (CHEBI:51026) |
| ansaetherone (CHEBI:65412) is a monosaccharide derivative (CHEBI:63367) |
| ansaetherone (CHEBI:65412) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2S,3E,5Z,14S,15R)-5-ethylidene-11-hydroxy-14-{[(2R,5R,6R)-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-3,7,15-trimethyl-2,5-dihydro-2,13-ethano-1,9-benzoxazacycloundecine-6,8(7H,9H)-dione |