EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O2 |
| Net Charge | 0 |
| Average Mass | 266.340 |
| Monoisotopic Mass | 266.13068 |
| SMILES | C=C(Cc1ccc(O)cc1)C(=C)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C18H18O2/c1-13(11-15-3-7-17(19)8-4-15)14(2)12-16-5-9-18(20)10-6-16/h3-10,19-20H,1-2,11-12H2 |
| InChIKey | VVKZAZVVUAFFGF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anogeissus acuminata (ncbitaxon:155018) | stem (BTO:0001300) | PubMed (7525878) | Ground stem |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anolignan B (CHEBI:65411) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| anolignan B (CHEBI:65411) has role metabolite (CHEBI:25212) |
| anolignan B (CHEBI:65411) is a lignan (CHEBI:25036) |
| anolignan B (CHEBI:65411) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-[3-(4-hydroxybenzyl)-2-methylidenebut-3-en-1-yl]phenol |
| Synonyms | Source |
|---|---|
| 4,4'-(2,3-bis(methylene)-1,4-butanediyl)bisphenol | ChemIDplus |
| 2,3-bis-(4-hydroxybenzyl)-1,3-butadiene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7812590 | Reaxys |
| CAS:158081-98-2 | ChemIDplus |
| Citations |
|---|