EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11N5 |
| Net Charge | 0 |
| Average Mass | 261.288 |
| Monoisotopic Mass | 261.10145 |
| SMILES | Nc1nccc(-c2nccc3c2nc2ccccc23)n1 |
| InChI | InChI=1S/C15H11N5/c16-15-18-8-6-12(20-15)14-13-10(5-7-17-14)9-3-1-2-4-11(9)19-13/h1-8,19H,(H2,16,18,20) |
| InChIKey | IUDMZJRPDRCJEB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annona montana (ncbitaxon:49857) | |||
| trunk bark (BTO:0001494) | DOI (10.1039/P19820001205) | ||
| root (BTO:0001188) | DOI (10.1039/P19820001205) | Previous component: root bark; | |
| Annona foteida (IPNI:72204-1) | bark (BTO:0001301) | PubMed (16499336) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| annomontine (CHEBI:65409) has functional parent pyrimidin-2-amine (CHEBI:38618) |
| annomontine (CHEBI:65409) has functional parent β-carboline (CHEBI:109895) |
| annomontine (CHEBI:65409) has role antiparasitic agent (CHEBI:35442) |
| annomontine (CHEBI:65409) has role metabolite (CHEBI:25212) |
| annomontine (CHEBI:65409) is a alkaloid (CHEBI:22315) |
| annomontine (CHEBI:65409) is a aminopyrimidine (CHEBI:38338) |
| annomontine (CHEBI:65409) is a β-carbolines (CHEBI:60834) |
| IUPAC Name |
|---|
| 4-(9H-β-carbolin-1-yl)pyrimidin-2-amine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5567152 | Reaxys |
| CAS:82504-00-5 | ChemIDplus |
| Citations |
|---|