EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | [H][C@]12CCC(=C)[C@@H](C/C=C3/C(=O)OC[C@H]3O)[C@]1(C)CC[C@@H](O)[C@@]2(C)CO |
| InChI | InChI=1S/C20H30O5/c1-12-4-7-16-19(2,9-8-17(23)20(16,3)11-21)14(12)6-5-13-15(22)10-25-18(13)24/h5,14-17,21-23H,1,4,6-11H2,2-3H3/b13-5+/t14-,15-,16+,17-,19+,20+/m1/s1 |
| InChIKey | BOJKULTULYSRAS-OTESTREVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Andrographis paniculata (ncbitaxon:175694) | |||
| leaf (BTO:0000713) | PubMed (15894448) | ||
| root (BTO:0001188) | PubMed (15894448) | ||
| leaf (BTO:0000713) | PubMed (22026410) | Dried leaves |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| andrographolide (CHEBI:65408) has role anti-HIV agent (CHEBI:64946) |
| andrographolide (CHEBI:65408) has role anti-inflammatory drug (CHEBI:35472) |
| andrographolide (CHEBI:65408) has role antineoplastic agent (CHEBI:35610) |
| andrographolide (CHEBI:65408) has role metabolite (CHEBI:25212) |
| andrographolide (CHEBI:65408) is a carbobicyclic compound (CHEBI:36785) |
| andrographolide (CHEBI:65408) is a labdane diterpenoid (CHEBI:36770) |
| andrographolide (CHEBI:65408) is a primary alcohol (CHEBI:15734) |
| andrographolide (CHEBI:65408) is a secondary alcohol (CHEBI:35681) |
| andrographolide (CHEBI:65408) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3E,4S)-4-hydroxy-3-{2-[(1R,4aS,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidenedecahydronaphthalen-1-yl]ethylidene}dihydrofuran-2(3H)-one |
| Synonyms | Source |
|---|---|
| (1R-(1-α(E(S)),4aβ,5α,6α,8aα))-3-(2-(decahydro-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylene-1-naphthalenyl)ethylidene)dihydro-4-hydroxy-2(3H)-furanone | ChemIDplus |
| 3-(2-(decahydro-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylenenaphthyl)ethylidene)dihydro-4-hydroxyfuran-2(3H)-one | ChemIDplus |
| 3α,14,15,18-tetrahydroxy-5b,9bH,10a-labda-8(20),12-dien-16-oic acid γ-Lactone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Andrographolide | Wikipedia |
| C20214 | KEGG COMPOUND |
| CN102397273 | Patent |
| EP2411004 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5609598 | Reaxys |
| CAS:5508-58-7 | ChemIDplus |
| Citations |
|---|