EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | [H][C@]12CCC(=C)[C@@H](C/C=C3/C(=O)OC[C@H]3O)[C@]1(C)CC[C@@H](O)[C@@]2(C)CO |
| InChI | InChI=1S/C20H30O5/c1-12-4-7-16-19(2,9-8-17(23)20(16,3)11-21)14(12)6-5-13-15(22)10-25-18(13)24/h5,14-17,21-23H,1,4,6-11H2,2-3H3/b13-5+/t14-,15-,16+,17-,19+,20+/m1/s1 |
| InChIKey | BOJKULTULYSRAS-OTESTREVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Andrographis paniculata (ncbitaxon:175694) | |||
| leaf (BTO:0000713) | PubMed (15894448) | ||
| root (BTO:0001188) | PubMed (15894448) | ||
| leaf (BTO:0000713) | PubMed (22026410) | Dried leaves |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| andrographolide (CHEBI:65408) has role anti-HIV agent (CHEBI:64946) |
| andrographolide (CHEBI:65408) has role anti-inflammatory drug (CHEBI:35472) |
| andrographolide (CHEBI:65408) has role antineoplastic agent (CHEBI:35610) |
| andrographolide (CHEBI:65408) has role metabolite (CHEBI:25212) |
| andrographolide (CHEBI:65408) is a carbobicyclic compound (CHEBI:36785) |
| andrographolide (CHEBI:65408) is a labdane diterpenoid (CHEBI:36770) |
| andrographolide (CHEBI:65408) is a primary alcohol (CHEBI:15734) |
| andrographolide (CHEBI:65408) is a secondary alcohol (CHEBI:35681) |
| andrographolide (CHEBI:65408) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3E,4S)-4-hydroxy-3-{2-[(1R,4aS,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidenedecahydronaphthalen-1-yl]ethylidene}dihydrofuran-2(3H)-one |
| Synonyms | Source |
|---|---|
| (1R-(1-α(E(S)),4aβ,5α,6α,8aα))-3-(2-(decahydro-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylene-1-naphthalenyl)ethylidene)dihydro-4-hydroxy-2(3H)-furanone | ChemIDplus |
| 3-(2-(decahydro-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylenenaphthyl)ethylidene)dihydro-4-hydroxyfuran-2(3H)-one | ChemIDplus |
| 3α,14,15,18-tetrahydroxy-5b,9bH,10a-labda-8(20),12-dien-16-oic acid γ-Lactone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Andrographolide | Wikipedia |
| C20214 | KEGG COMPOUND |
| CN102397273 | Patent |
| EP2411004 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5609598 | Reaxys |
| CAS:5508-58-7 | ChemIDplus |
| Citations |
|---|