EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27NO4 |
| Net Charge | 0 |
| Average Mass | 405.494 |
| Monoisotopic Mass | 405.19401 |
| SMILES | COc1cc(OC)c(-c2c(C)cc3cccc(OC)c3c2O)c2c1C(C)=N[C@@H](C)C2 |
| InChI | InChI=1S/C25H27NO4/c1-13-10-16-8-7-9-18(28-4)23(16)25(27)21(13)24-17-11-14(2)26-15(3)22(17)19(29-5)12-20(24)30-6/h7-10,12,14,27H,11H2,1-6H3/t14-/m0/s1 |
| InChIKey | QGIHYQPVZRSTNP-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ancistrocladus tanzaniensis (ncbitaxon:714107) | leaf (BTO:0000713) | PubMed (14510589) |
| Roles Classification |
|---|
| Biological Roles: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ancistrotanzanine A (CHEBI:65406) has role antileishmanial agent (CHEBI:70868) |
| ancistrotanzanine A (CHEBI:65406) has role antiplasmodial drug (CHEBI:64915) |
| ancistrotanzanine A (CHEBI:65406) has role metabolite (CHEBI:25212) |
| ancistrotanzanine A (CHEBI:65406) has role trypanocidal drug (CHEBI:36335) |
| ancistrotanzanine A (CHEBI:65406) is a aromatic ether (CHEBI:35618) |
| ancistrotanzanine A (CHEBI:65406) is a biaryl (CHEBI:64459) |
| ancistrotanzanine A (CHEBI:65406) is a isoquinoline alkaloid (CHEBI:24921) |
| ancistrotanzanine A (CHEBI:65406) is a isoquinolines (CHEBI:24922) |
| ancistrotanzanine A (CHEBI:65406) is a methoxynaphthalene (CHEBI:48851) |
| ancistrotanzanine A (CHEBI:65406) is a methylnaphthalenes (CHEBI:25324) |
| ancistrotanzanine A (CHEBI:65406) is a naphthols (CHEBI:25392) |
| IUPAC Name |
|---|
| 2-[(3S)-6,8-dimethoxy-1,3-dimethyl-3,4-dihydroisoquinolin-5-yl]-8-methoxy-3-methylnaphthalen-1-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9816658 | Reaxys |
| Citations |
|---|