EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O4 |
| Net Charge | 0 |
| Average Mass | 434.661 |
| Monoisotopic Mass | 434.33961 |
| SMILES | CCCCCCCCCCCCCCC[C@@H](O)CC1(OC)CCC2(C=CC(=O)C=C2)O1 |
| InChI | InChI=1S/C27H46O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-25(29)23-27(30-2)22-21-26(31-27)19-17-24(28)18-20-26/h17-20,25,29H,3-16,21-23H2,1-2H3/t25-,27?/m1/s1 |
| InChIKey | LOBKLUVDTHVJSR-CSMDKSQMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amomum aculeatum (ncbitaxon:1076729) | leaf (BTO:0000713) | PubMed (18260638) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amomol A (CHEBI:65404) has role antineoplastic agent (CHEBI:35610) |
| amomol A (CHEBI:65404) has role plant metabolite (CHEBI:76924) |
| amomol A (CHEBI:65404) is a cyclic ketal (CHEBI:59779) |
| amomol A (CHEBI:65404) is a enone (CHEBI:51689) |
| amomol A (CHEBI:65404) is a oxaspiro compound (CHEBI:37948) |
| amomol A (CHEBI:65404) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 2-[(2R)-2-hydroxyheptadecyl]-2-methoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one |
| Synonyms | Source |
|---|---|
| 2ξ,12R-2-(2-hydroxyheptadecyl)-2-methoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one | ChEBI |
| (−)-amomol A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18832055 | Reaxys |
| Citations |
|---|