EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32N2 |
| Net Charge | 0 |
| Average Mass | 372.556 |
| Monoisotopic Mass | 372.25655 |
| SMILES | [H][C@@]12c3c(C(C)(C)C=C)nc4cccc(c34)C(C)(C)[C@@]1([H])CC[C@](C)(C=C)[C@@H]2[N+]#[C-] |
| InChI | InChI=1S/C26H32N2/c1-9-24(3,4)22-21-19-16(12-11-13-18(19)28-22)25(5,6)17-14-15-26(7,10-2)23(27-8)20(17)21/h9-13,17,20,23,28H,1-2,14-15H2,3-7H3/t17-,20-,23+,26-/m0/s1 |
| InChIKey | DBOXZAYTFKDLHJ-CSOFANMDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fischerella (ncbitaxon:1190) | - | PubMed (17315959) | MeOH-Water extract (7:3) of Cyanobacterium culture |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ambiguine H (CHEBI:65400) has role antibacterial agent (CHEBI:33282) |
| ambiguine H (CHEBI:65400) has role antifungal agent (CHEBI:35718) |
| ambiguine H (CHEBI:65400) has role bacterial metabolite (CHEBI:76969) |
| ambiguine H (CHEBI:65400) is a ambiguine (CHEBI:141618) |
| ambiguine H (CHEBI:65400) is a isocyanide (CHEBI:35353) |
| ambiguine H (CHEBI:65400) is a organic heterotetracyclic compound (CHEBI:38163) |
| ambiguine H (CHEBI:65400) is conjugate base of ambiguine H(1+) (CHEBI:229756) |
| Incoming Relation(s) |
| ambiguine H(1+) (CHEBI:229756) is conjugate acid of ambiguine H (CHEBI:65400) |
| IUPAC Name |
|---|
| (6aS,9R,10R,10aS)-9-ethenyl-10-isocyano-6,6,9-trimethyl-1-(2-methylbut-3-en-2-yl)-2,6,6a,7,8,9,10,10a-octahydronaphtho[1,2,3-cd]indole |
| Synonyms | Source |
|---|---|
| (+)-ambiguine H | ChEBI |
| ambiguine H isonitrile | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 17214460 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18851757 | Reaxys |
| Citations |
|---|