EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26O9 |
| Net Charge | 0 |
| Average Mass | 470.474 |
| Monoisotopic Mass | 470.15768 |
| SMILES | [H][C@]1([C@]2([H])O[C@@H](O)[C@H](O)[C@H](OC(=O)C=C(C)C)[C@H]2O)c2cccc(O)c2C(=O)c2c(O)cc(C)cc21 |
| InChI | InChI=1S/C25H26O9/c1-10(2)7-16(28)33-24-21(30)23(34-25(32)22(24)31)17-12-5-4-6-14(26)18(12)20(29)19-13(17)8-11(3)9-15(19)27/h4-9,17,21-27,30-32H,1-3H3/t17-,21-,22+,23-,24+,25+/m0/s1 |
| InChIKey | XVEVCPOACUOIOH-AEPXPHGDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alvaradoa haitiensis (IPNI:10503-2) | leaf (BTO:0000713) | PubMed (17552563) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alvaradoin M (CHEBI:65398) has functional parent 3-methylbut-2-enoic acid (CHEBI:37127) |
| alvaradoin M (CHEBI:65398) has role antineoplastic agent (CHEBI:35610) |
| alvaradoin M (CHEBI:65398) has role metabolite (CHEBI:25212) |
| alvaradoin M (CHEBI:65398) is a C-glycosyl compound (CHEBI:20857) |
| alvaradoin M (CHEBI:65398) is a anthracenes (CHEBI:46955) |
| alvaradoin M (CHEBI:65398) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (5R)-5-[(9S)-4,5-dihydroxy-2-methyl-10-oxo-9,10-dihydroanthracen-9-yl]-3-O-(3-methylbut-2-enoyl)-α-L-lyxopyranose |
| Synonym | Source |
|---|---|
| (10S)-C-(3-O-senecioyl)-β-L-lyxopyranosyl-1,8-dihydroxy-3-methylanthracen-9(10H)-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11184545 | Reaxys |
| Citations |
|---|