EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28O10 |
| Net Charge | 0 |
| Average Mass | 512.511 |
| Monoisotopic Mass | 512.16825 |
| SMILES | [H][C@]1([C@]2([H])O[C@@H](OC(C)=O)[C@H](O)[C@H](OC(=O)C=C(C)C)[C@H]2O)c2cccc(O)c2C(=O)c2c(O)cc(C)cc21 |
| InChI | InChI=1S/C27H28O10/c1-11(2)8-18(31)36-26-23(33)25(37-27(24(26)34)35-13(4)28)19-14-6-5-7-16(29)20(14)22(32)21-15(19)9-12(3)10-17(21)30/h5-10,19,23-27,29-30,33-34H,1-4H3/t19-,23-,24+,25-,26+,27+/m0/s1 |
| InChIKey | NVWRUTJMHZBGQX-VJXMHWMPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alvaradoa haitiensis (IPNI:10503-2) | leaf (BTO:0000713) | PubMed (17552563) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alvaradoin H (CHEBI:65393) has functional parent 3-methylbut-2-enoic acid (CHEBI:37127) |
| alvaradoin H (CHEBI:65393) has role antineoplastic agent (CHEBI:35610) |
| alvaradoin H (CHEBI:65393) has role metabolite (CHEBI:25212) |
| alvaradoin H (CHEBI:65393) is a C-glycosyl compound (CHEBI:20857) |
| alvaradoin H (CHEBI:65393) is a acetate ester (CHEBI:47622) |
| alvaradoin H (CHEBI:65393) is a anthracenes (CHEBI:46955) |
| alvaradoin H (CHEBI:65393) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (5S)-1-O-acetyl-5-[(9S)-4,5-dihydroxy-2-methyl-10-oxo-9,10-dihydroanthracen-9-yl]-3-O-(3-methylbut-2-enoyl)-α-L-lyxopyranose |
| Synonym | Source |
|---|---|
| (10S)-C-(1-O-acetyl-3-O-senecioyl)-β-L-lyxopyranosyl-1,8-dihydroxy-3-methylanthracen-9(10H)-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11184550 | Reaxys |
| Citations |
|---|