EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H26O13 |
| Net Charge | 0 |
| Average Mass | 618.547 |
| Monoisotopic Mass | 618.13734 |
| SMILES | COc1cc2c(c(O)c1-c1c(OC)cc(O)c3c1C(=O)C1=C(C3=O)[C@H](O)[C@@H](O)[C@@](C)(O)[C@@H]1O)C(=O)c1cc(O)c(C)cc1C2=O |
| InChI | InChI=1S/C32H26O13/c1-9-5-10-11(6-13(9)33)25(36)17-12(24(10)35)7-15(44-3)20(26(17)37)19-16(45-4)8-14(34)18-21(19)28(39)23-22(27(18)38)29(40)31(42)32(2,43)30(23)41/h5-8,29-31,33-34,37,40-43H,1-4H3/t29-,30+,31+,32-/m0/s1 |
| InChIKey | WNKYPOGUIDZODB-BVEPWEIPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemphylium globuliferum (ncbitaxon:245170) | - | PubMed (19271717) | Endophytic fungi isolated from stem tissue of Mentha pulegium |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alterporriol G and H (Atropisomers) (CHEBI:65389) has role metabolite (CHEBI:25212) |
| Alterporriol G and H (Atropisomers) (CHEBI:65389) is a dihydroxyanthraquinone (CHEBI:37484) |
| Citations |
|---|