EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O6 |
| Net Charge | 0 |
| Average Mass | 464.558 |
| Monoisotopic Mass | 464.21989 |
| SMILES | CC(C)=CCc1c(O)cc2oc3c(c(=O)c2c1O)C(CC=C(C)C)(CC=C(C)C)C(=O)C(O)=C3 |
| InChI | InChI=1S/C28H32O6/c1-15(2)7-8-18-19(29)13-21-23(25(18)31)26(32)24-22(34-21)14-20(30)27(33)28(24,11-9-16(3)4)12-10-17(5)6/h7,9-10,13-14,29-31H,8,11-12H2,1-6H3 |
| InChIKey | QEJCXVUCARKGSY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allanblackia monticola (IPNI:427045-1) | stem (BTO:0001300) | PubMed (16394561) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| allanxanthone C (CHEBI:65387) has role antineoplastic agent (CHEBI:35610) |
| allanxanthone C (CHEBI:65387) has role antiplasmodial drug (CHEBI:64915) |
| allanxanthone C (CHEBI:65387) has role metabolite (CHEBI:25212) |
| allanxanthone C (CHEBI:65387) is a polyphenol (CHEBI:26195) |
| allanxanthone C (CHEBI:65387) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 3,6,8-trihydroxy-1,1,7-tris(3-methylbut-2-en-1-yl)-1H-xanthene-2,9-dione |
| Synonym | Source |
|---|---|
| 3-hydroxyapetalinone C | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10311273 | Reaxys |
| Citations |
|---|