EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O4 |
| Net Charge | 0 |
| Average Mass | 272.385 |
| Monoisotopic Mass | 272.19876 |
| SMILES | [H][C@@]12CC[C@@](C)(O)[C@]1([H])[C@H](O)[C@](O)(C(C)C)CC[C@]2(C)O |
| InChI | InChI=1S/C15H28O4/c1-9(2)15(19)8-7-13(3,17)10-5-6-14(4,18)11(10)12(15)16/h9-12,16-19H,5-8H2,1-4H3/t10-,11+,12+,13+,14-,15-/m1/s1 |
| InChIKey | MAZFBCJNIUKTID-MNQBEEPXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alisma orientale (ncbitaxon:262913) | rhizome (BTO:0001181) | PubMed (17541191) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alismorientol A (CHEBI:65386) has role anti-HBV agent (CHEBI:64951) |
| alismorientol A (CHEBI:65386) has role metabolite (CHEBI:25212) |
| alismorientol A (CHEBI:65386) is a carbobicyclic compound (CHEBI:36785) |
| alismorientol A (CHEBI:65386) is a guaiane sesquiterpenoid (CHEBI:36744) |
| alismorientol A (CHEBI:65386) is a secondary alcohol (CHEBI:35681) |
| alismorientol A (CHEBI:65386) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1R,3aR,4S,7R,8S,8aS)-1,4-dimethyl-7-(propan-2-yl)decahydroazulene-1,4,7,8-tetrol |
| Synonym | Source |
|---|---|
| 4α,6β,7α,10β-tetrahydroxy-1,5-cis-guaiane | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11226985 | Reaxys |
| Citations |
|---|