EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O8 |
| Net Charge | 0 |
| Average Mass | 452.459 |
| Monoisotopic Mass | 452.14712 |
| SMILES | COc1cc([C@H]2Oc3cc(/C=C/c4cc(O)cc(O)c4)ccc3O[C@@H]2CO)cc(OC)c1O |
| InChI | InChI=1S/C25H24O8/c1-30-21-10-16(11-22(31-2)24(21)29)25-23(13-26)32-19-6-5-14(9-20(19)33-25)3-4-15-7-17(27)12-18(28)8-15/h3-12,23,25-29H,13H2,1-2H3/b4-3+/t23-,25-/m1/s1 |
| InChIKey | KDMFHGGHQLUIRH-OOODPRFPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aiphanes aculeata (ncbitaxon:131249) | seed (BTO:0001226) | PubMed (11440571) |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aiphanol (CHEBI:65377) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| aiphanol (CHEBI:65377) is a aromatic ether (CHEBI:35618) |
| aiphanol (CHEBI:65377) is a benzodioxine (CHEBI:64096) |
| aiphanol (CHEBI:65377) is a lignan (CHEBI:25036) |
| aiphanol (CHEBI:65377) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| 5-{(E)-2-[(2R,3R)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethenyl}benzene-1,3-diol |
| Synonym | Source |
|---|---|
| (+)-aiphanol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8952721 | Reaxys |
| Citations |
|---|