EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34O7 |
| Net Charge | 0 |
| Average Mass | 506.595 |
| Monoisotopic Mass | 506.23045 |
| SMILES | [H][C@]12OC(=O)C(=C)[C@]1([H])CCC(=C)[C@]1([H])CC(=O)[C@]3(CC[C@@]4(O)[C@]3(O)C[C@@]3([H])C(=C)CC[C@@]5([H])C(=C)C(=O)O[C@]5([H])[C@@]43[H])[C@]21[H] |
| InChI | InChI=1S/C30H34O7/c1-13-5-7-17-15(3)26(32)36-24(17)22-19(13)11-21(31)28(22)9-10-29(34)23-20(12-30(28,29)35)14(2)6-8-18-16(4)27(33)37-25(18)23/h17-20,22-25,34-35H,1-12H2/t17-,18-,19-,20-,22-,23-,24-,25-,28+,29-,30-/m0/s1 |
| InChIKey | QYIHABZOQGFHJO-RLKQMHIPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ainsliaea macrocephala (ncbitaxon:418270) | whole plant (BTO:0001461) | PubMed (18484734) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ainsliadimer A (CHEBI:65376) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| ainsliadimer A (CHEBI:65376) has role metabolite (CHEBI:25212) |
| ainsliadimer A (CHEBI:65376) is a sesquiterpene lactone (CHEBI:37667) |
| ainsliadimer A (CHEBI:65376) is a spiro compound (CHEBI:33599) |
| IUPAC Name |
|---|
| (3aS,3a'S,6aR,6a'R,7a'S,9R,9aR,9bS,10a'S,10b'S,10c'S)-7a',10a'-dihydroxy-3,3',6,6'-tetramethylideneicosahydro-2H-spiro[azuleno[4,5-b]furan-9,8'-cyclopenta[2,3]azuleno[4,5-b]furan]-2,2',8(3H,3'H)-trione |
| Synonym | Source |
|---|---|
| (+)-ainsliadimer A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19020292 | Reaxys |
| Citations |
|---|