EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34N2O4S2 |
| Net Charge | 0 |
| Average Mass | 466.669 |
| Monoisotopic Mass | 466.19600 |
| SMILES | [H][C@@]1([C@@H](O)C(C)(C)C(=O)O)CS[C@@]([H])([C@@]2([H])CSC(c3c(O)cccc3CCCCC)=N2)N1C |
| InChI | InChI=1S/C23H34N2O4S2/c1-5-6-7-9-14-10-8-11-17(26)18(14)20-24-15(12-30-20)21-25(4)16(13-31-21)19(27)23(2,3)22(28)29/h8,10-11,15-16,19,21,26-27H,5-7,9,12-13H2,1-4H3,(H,28,29)/t15-,16+,19-,21+/m1/s1 |
| InChIKey | QZBCDLLHQSDFIG-ZEVBXJOLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Agrobacterium sp. (ncbitaxon:361) | - | PubMed (10656570) | Marine Agrobacterium |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agrochelin (CHEBI:65375) has role antimicrobial agent (CHEBI:33281) |
| agrochelin (CHEBI:65375) has role metabolite (CHEBI:25212) |
| agrochelin (CHEBI:65375) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| agrochelin (CHEBI:65375) is a phenols (CHEBI:33853) |
| agrochelin (CHEBI:65375) is a thiazolidines (CHEBI:35622) |
| IUPAC Name |
|---|
| (3S)-3-hydroxy-3-{(2S,4R)-2-[(4R)-2-(2-hydroxy-6-pentylphenyl)-4,5-dihydro-1,3-thiazol-4-yl]-3-methyl-1,3-thiazolidin-4-yl}-2,2-dimethylpropanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8520154 | Reaxys |
| Citations |
|---|