EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H28O8 |
| Net Charge | 0 |
| Average Mass | 492.524 |
| Monoisotopic Mass | 492.17842 |
| SMILES | COC(=O)[C@H]1[C@@H](O)[C@@]2(O)c3c(OC)cc(OC)cc3O[C@@]2(c2ccc(OC)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H28O8/c1-32-18-12-10-17(11-13-18)28-23(16-8-6-5-7-9-16)22(26(30)35-4)25(29)27(28,31)24-20(34-3)14-19(33-2)15-21(24)36-28/h5-15,22-23,25,29,31H,1-4H3/t22-,23-,25-,27+,28+/m1/s1 |
| InChIKey | VFTGDXPPYSWBSO-GWNOIRNCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia elliptifolia (IPNI:577069-1) | stem (BTO:0001300) | DOI (10.1016/0014-2999(92)90156-X) | |
| Aglaia odorata (ncbitaxon:210347) | leaf (BTO:0000713) | DOI (10.1016/S0031-9422(00)94986-0) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aglafolin (CHEBI:65374) has role metabolite (CHEBI:25212) |
| aglafolin (CHEBI:65374) has role platelet aggregation inhibitor (CHEBI:50427) |
| aglafolin (CHEBI:65374) is a methyl ester (CHEBI:25248) |
| aglafolin (CHEBI:65374) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| methyl (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3,3a,8b-tetrahydro-1H-benzo[b]cyclopenta[d]furan-2-carboxylate |
| Synonyms | Source |
|---|---|
| methyl rocaglate | ChEBI |
| aglafoline | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7672470 | Reaxys |
| CAS:143901-35-3 | ChemIDplus |
| Citations |
|---|