EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H22O6 |
| Net Charge | 0 |
| Average Mass | 466.489 |
| Monoisotopic Mass | 466.14164 |
| SMILES | O=C(CCc1ccccc1)c1c(O)c(Cc2ccccc2O)c(O)c2c(=O)c3ccccc3oc12 |
| InChI | InChI=1S/C29H22O6/c30-21-12-6-4-10-18(21)16-20-27(33)24(22(31)15-14-17-8-2-1-3-9-17)29-25(28(20)34)26(32)19-11-5-7-13-23(19)35-29/h1-13,30,33-34H,14-16H2 |
| InChIKey | NIFSYUFGZVWGGD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Uvaria acuminata (ncbitaxon:672960) | root (BTO:0001188) | PubMed (14709883) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acumitin (CHEBI:65369) has role antineoplastic agent (CHEBI:35610) |
| acumitin (CHEBI:65369) has role metabolite (CHEBI:25212) |
| acumitin (CHEBI:65369) is a dihydrochalcones (CHEBI:71230) |
| acumitin (CHEBI:65369) is a phenols (CHEBI:33853) |
| acumitin (CHEBI:65369) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,3-dihydroxy-2-(2-hydroxybenzyl)-4-(3-phenylpropanoyl)-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9740342 | Reaxys |
| Citations |
|---|