EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44O5 |
| Net Charge | 0 |
| Average Mass | 436.633 |
| Monoisotopic Mass | 436.31887 |
| SMILES | CCCCCCCCCCCCC[C@@H]1C[C@@H](O)C[C@@]2(CC[C@]3(C=CC(=O)C[C@@H]3O)O2)O1 |
| InChI | InChI=1S/C26H44O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-23-18-22(28)20-26(30-23)17-16-25(31-26)15-14-21(27)19-24(25)29/h14-15,22-24,28-29H,2-13,16-20H2,1H3/t22-,23-,24+,25+,26+/m1/s1 |
| InChIKey | UBFNRKJKPNNCHD-JMTTVTNBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amomum aculeatum (ncbitaxon:1076729) | leaf (BTO:0000713) | PubMed (18260638) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aculeatol E (CHEBI:65368) has role antineoplastic agent (CHEBI:35610) |
| aculeatol E (CHEBI:65368) has role metabolite (CHEBI:25212) |
| aculeatol E (CHEBI:65368) is a enone (CHEBI:51689) |
| aculeatol E (CHEBI:65368) is a organic heterotricyclic compound (CHEBI:26979) |
| aculeatol E (CHEBI:65368) is a oxaspiro compound (CHEBI:37948) |
| aculeatol E (CHEBI:65368) is a spiroketal (CHEBI:72600) |
| IUPAC Name |
|---|
| (2R,4R,6S,8R,13S)-4,13-dihydroxy-2-tridecyl-1,7-dioxadispiro[5.1.5.2]pentadec-9-en-11-one |
| Synonym | Source |
|---|---|
| (2R,4R,6S,8R,9S)-4,9-dihydroxy-2-tridecyl-1,7-dioxadispiro[5.1.5.2]pentadec-12-en-11-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18832053 | Reaxys |
| Citations |
|---|