EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35NO5 |
| Net Charge | 0 |
| Average Mass | 417.546 |
| Monoisotopic Mass | 417.25152 |
| SMILES | [H][C@]12CC[C@]3(OC(C)=O)[C@@]([H])(C(=O)O1)[C@@]([H])(C2)C12C4N(CC)C[C@](C)(CC[C@@H]1OC)[C@@]2([H])C[C@@]43[H] |
| InChI | InChI=1S/C24H35NO5/c1-5-25-12-22(3)8-7-18(28-4)24-15-10-14-6-9-23(30-13(2)26,19(15)21(27)29-14)16(20(24)25)11-17(22)24/h14-20H,5-12H2,1-4H3/t14-,15-,16+,17-,18+,19-,20?,22+,23-,24?/m1/s1 |
| InChIKey | IYIKMJOMHPPBMO-FTTJKWPISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Delphinium denudatum (IPNI:710557-1) | root (BTO:0001188) | PubMed (9170290) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-acetoxyheterophyllisine (CHEBI:65367) has role antifungal agent (CHEBI:35718) |
| 8-acetoxyheterophyllisine (CHEBI:65367) is a acetate ester (CHEBI:47622) |
| 8-acetoxyheterophyllisine (CHEBI:65367) is a bridged compound (CHEBI:35990) |
| 8-acetoxyheterophyllisine (CHEBI:65367) is a diterpene alkaloid (CHEBI:23847) |
| 8-acetoxyheterophyllisine (CHEBI:65367) is a ether (CHEBI:25698) |
| 8-acetoxyheterophyllisine (CHEBI:65367) is a tertiary amine (CHEBI:32876) |
| 8-acetoxyheterophyllisine (CHEBI:65367) is a δ-lactone (CHEBI:18946) |
| Citations |
|---|