EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O5 |
| Net Charge | 0 |
| Average Mass | 444.612 |
| Monoisotopic Mass | 444.28757 |
| SMILES | [H][C@]12C[C@@H](OC(C)=O)[C@@]3(C)[C@@]([H])(C[C@H](O)C4=CC(=O)O[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C27H40O5/c1-15(28)31-21-14-19-25(4)10-7-9-24(2,3)18(25)8-11-26(19,5)20-13-17(29)16-12-22(30)32-23(16)27(20,21)6/h12,17-21,23,29H,7-11,13-14H2,1-6H3/t17-,18-,19+,20-,21+,23-,25-,26+,27+/m0/s1 |
| InChIKey | TUHLUXIESILORF-ZWRXBZFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyrtios erectus (ncbitaxon:279628) | |||
| - | PubMed (8778242) | ||
| - | PubMed (8778242) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-O-acetyl-16-O-deacetyl-16-epi-scalarobutenolide (CHEBI:65366) has role antineoplastic agent (CHEBI:35610) |
| 12-O-acetyl-16-O-deacetyl-16-epi-scalarobutenolide (CHEBI:65366) has role metabolite (CHEBI:25212) |
| 12-O-acetyl-16-O-deacetyl-16-epi-scalarobutenolide (CHEBI:65366) is a acetate ester (CHEBI:47622) |
| 12-O-acetyl-16-O-deacetyl-16-epi-scalarobutenolide (CHEBI:65366) is a organic heteropentacyclic compound (CHEBI:38164) |
| 12-O-acetyl-16-O-deacetyl-16-epi-scalarobutenolide (CHEBI:65366) is a scalarane sesterterpenoid (CHEBI:59370) |
| 12-O-acetyl-16-O-deacetyl-16-epi-scalarobutenolide (CHEBI:65366) is a secondary alcohol (CHEBI:35681) |
| 12-O-acetyl-16-O-deacetyl-16-epi-scalarobutenolide (CHEBI:65366) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (4S,5aS,5bR,7aS,11aS,11bR,13R,13aR,13bS)-4-hydroxy-5b,8,8,11a,13a-pentamethyl-2-oxo-2,4,5,5a,5b,6,7,7a,8,9,10,11,11a,11b,12,13,13a,13b-octadecahydrochryseno[1,2-b]furan-13-yl acetate |
| Synonym | Source |
|---|---|
| Hyrtios sesterterpene 2 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9236584 | Reaxys |
| Citations |
|---|