EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O5 |
| Net Charge | 0 |
| Average Mass | 308.374 |
| Monoisotopic Mass | 308.16237 |
| SMILES | [H][C@@]12CC(C)=C([C@H](C)CCCOC(C)=O)[C@@H](O)[C@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C17H24O5/c1-9(6-5-7-21-12(4)18)14-10(2)8-13-15(16(14)19)11(3)17(20)22-13/h9,13,15-16,19H,3,5-8H2,1-2,4H3/t9-,13-,15-,16-/m1/s1 |
| InChIKey | QKUFZFLZBUSEHN-BYRYDROYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula japonica (ncbitaxon:453958) | - | DOI (10.1016/S0031-9422(00)90813-6) | |
| Microtropis japonica (ncbitaxon:1089418) | flower (BTO:0000469) | PubMed (14969344) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-O-acetyl-4R,6S-britannilactone (CHEBI:65365) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| 1-O-acetyl-4R,6S-britannilactone (CHEBI:65365) has role metabolite (CHEBI:25212) |
| 1-O-acetyl-4R,6S-britannilactone (CHEBI:65365) is a acetate ester (CHEBI:47622) |
| 1-O-acetyl-4R,6S-britannilactone (CHEBI:65365) is a organic heterobicyclic compound (CHEBI:27171) |
| 1-O-acetyl-4R,6S-britannilactone (CHEBI:65365) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (4R)-4-[(3aS,4S,7aR)-4-hydroxy-6-methyl-3-methylidene-2-oxo-2,3,3a,4,7,7a-hexahydro-1-benzofuran-5-yl]pentyl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11296086 | Reaxys |
| Citations |
|---|