EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O5 |
| Net Charge | 0 |
| Average Mass | 308.374 |
| Monoisotopic Mass | 308.16237 |
| SMILES | [H][C@@]12CC(C)=C([C@H](C)CCCOC(C)=O)[C@@H](O)[C@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C17H24O5/c1-9(6-5-7-21-12(4)18)14-10(2)8-13-15(16(14)19)11(3)17(20)22-13/h9,13,15-16,19H,3,5-8H2,1-2,4H3/t9-,13-,15-,16-/m1/s1 |
| InChIKey | QKUFZFLZBUSEHN-BYRYDROYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula japonica (ncbitaxon:453958) | - | DOI (10.1016/S0031-9422(00)90813-6) | |
| Microtropis japonica (ncbitaxon:1089418) | flower (BTO:0000469) | PubMed (14969344) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-O-acetyl-4R,6S-britannilactone (CHEBI:65365) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| 1-O-acetyl-4R,6S-britannilactone (CHEBI:65365) has role metabolite (CHEBI:25212) |
| 1-O-acetyl-4R,6S-britannilactone (CHEBI:65365) is a acetate ester (CHEBI:47622) |
| 1-O-acetyl-4R,6S-britannilactone (CHEBI:65365) is a organic heterobicyclic compound (CHEBI:27171) |
| 1-O-acetyl-4R,6S-britannilactone (CHEBI:65365) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (4R)-4-[(3aS,4S,7aR)-4-hydroxy-6-methyl-3-methylidene-2-oxo-2,3,3a,4,7,7a-hexahydro-1-benzofuran-5-yl]pentyl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11296086 | Reaxys |
| Citations |
|---|