EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O6 |
| Net Charge | 0 |
| Average Mass | 322.357 |
| Monoisotopic Mass | 322.14164 |
| SMILES | [H][C@@]12C=C[C@@](C)(O)[C@]1([H])[C@@]1([H])OC(=O)C(=C)[C@]1([H])[C@@H](OC(C)=O)C[C@@]2(C)O |
| InChI | InChI=1S/C17H22O6/c1-8-12-11(22-9(2)18)7-17(4,21)10-5-6-16(3,20)13(10)14(12)23-15(8)19/h5-6,10-14,20-21H,1,7H2,2-4H3/t10-,11+,12-,13+,14+,16-,17-/m1/s1 |
| InChIKey | RWFXDGCFFQYKOB-CYYZGTNASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chrysanthemum boreale (ncbitaxon:344871) | |||
| stem (BTO:0001300) | PubMed (18983901) | ||
| leaf (BTO:0000713) | PubMed (18983901) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-acetoxy-4,10-dihydroxy-2,11(13)-guaiadiene-12,6-olide (CHEBI:65363) has role antineoplastic agent (CHEBI:35610) |
| 8-acetoxy-4,10-dihydroxy-2,11(13)-guaiadiene-12,6-olide (CHEBI:65363) has role metabolite (CHEBI:25212) |
| 8-acetoxy-4,10-dihydroxy-2,11(13)-guaiadiene-12,6-olide (CHEBI:65363) is a acetate ester (CHEBI:47622) |
| 8-acetoxy-4,10-dihydroxy-2,11(13)-guaiadiene-12,6-olide (CHEBI:65363) is a organic heterotricyclic compound (CHEBI:26979) |
| 8-acetoxy-4,10-dihydroxy-2,11(13)-guaiadiene-12,6-olide (CHEBI:65363) is a sesquiterpene lactone (CHEBI:37667) |
| 8-acetoxy-4,10-dihydroxy-2,11(13)-guaiadiene-12,6-olide (CHEBI:65363) is a tertiary alcohol (CHEBI:26878) |
| 8-acetoxy-4,10-dihydroxy-2,11(13)-guaiadiene-12,6-olide (CHEBI:65363) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4S,6R,6aR,9R,9aS,9bS)-6,9-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-2,3,3a,4,5,6,6a,9,9a,9b-decahydroazuleno[4,5-b]furan-4-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18892294 | Reaxys |
| Citations |
|---|